C14H19N3O5 — CID 16736004
tert-butyl N-[2-(N-formyl-4-nitroanilino)ethyl]carbamate (PubChem CID 16736004) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is tert-butyl N-[2-(N-formyl-4-nitroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(N-formyl-4-nitroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 16736004 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | tert-butyl N-[2-(N-formyl-4-nitroanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(C=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H19N3O5/c1-14(2,3)22-13(19)15-8-9-16(10-18)11-4-6-12(7-5-11)17(20)21/h4-7,10H,8-9H2,1-3H3,(H,15,19) |
| InChIKey | CLKAIIRUASGJRC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|