C20H24N4O9S — CID 14622569
tert-butyl N-[2-[methyl-[3-nitro-4-(4-nitrophenoxy)phenyl]sulfonylamino]ethyl]carbamate (PubChem CID 14622569) has the molecular formula C20H24N4O9S and a molecular weight of 496.50 g/mol. Its IUPAC name is tert-butyl N-[2-[methyl-[3-nitro-4-(4-nitrophenoxy)phenyl]sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[methyl-[3-nitro-4-(4-nitrophenoxy)phenyl]sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 14622569 |
| Molecular Formula | C20H24N4O9S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | tert-butyl N-[2-[methyl-[3-nitro-4-(4-nitrophenoxy)phenyl]sulfonylamino]ethyl]carbamate |
| SMILES | CN(CCNC(=O)OC(C)(C)C)S(=O)(=O)c1ccc(Oc2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N4O9S/c1-20(2,3)33-19(25)21-11-12-22(4)34(30,31)16-9-10-18(17(13-16)24(28)29)32-15-7-5-14(6-8-15)23(26)27/h5-10,13H,11-12H2,1-4H3,(H,21,25) |
| InChIKey | MUQTUUPPUAYRIZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|