C21H25N3O8S — CID 139758682
tert-butyl N-[3-(N-methylsulfonyl-4-nitro-2-phenoxyanilino)-3-oxopropyl]carbamate (PubChem CID 139758682) has the molecular formula C21H25N3O8S and a molecular weight of 479.51 g/mol. Its IUPAC name is tert-butyl N-[3-(N-methylsulfonyl-4-nitro-2-phenoxyanilino)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-(N-methylsulfonyl-4-nitro-2-phenoxyanilino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 139758682 |
| Molecular Formula | C21H25N3O8S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | tert-butyl N-[3-(N-methylsulfonyl-4-nitro-2-phenoxyanilino)-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N(c1ccc([N+](=O)[O-])cc1Oc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H25N3O8S/c1-21(2,3)32-20(26)22-13-12-19(25)23(33(4,29)30)17-11-10-15(24(27)28)14-18(17)31-16-8-6-5-7-9-16/h5-11,14H,12-13H2,1-4H3,(H,22,26) |
| InChIKey | IPDHUZVNUKRRNK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|