C17H23N3O11S2 — CID 11684883
2-amino-2-(hydroxymethyl)propane-1,3-diol;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid (PubChem CID 11684883) has the molecular formula C17H23N3O11S2 and a molecular weight of 509.52 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid |
|---|---|
| PubChem CID | 11684883 |
| Molecular Formula | C17H23N3O11S2 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid |
| SMILES | CS(=O)(=O)N(c1ccc([N+](=O)[O-])cc1Oc1ccccc1)S(=O)(=O)O.NC(CO)(CO)CO |
| InChI | InChI=1S/C13H12N2O8S2.C4H11NO3/c1-24(18,19)15(25(20,21)22)12-8-7-10(14(16)17)9-13(12)23-11-5-3-2-4-6-11;5-4(1-6,2-7)3-8/h2-9H,1H3,(H,20,21,22);6-8H,1-3,5H2 |
| InChIKey | ROLKHQVIHAHTCM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 230.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|