C14H17N3O8S2 — CID 11704440
methanamine;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid (PubChem CID 11704440) has the molecular formula C14H17N3O8S2 and a molecular weight of 419.44 g/mol. Its IUPAC name is methanamine;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid.
| Compound Name | methanamine;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid |
|---|---|
| PubChem CID | 11704440 |
| Molecular Formula | C14H17N3O8S2 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | methanamine;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid |
| SMILES | CN.CS(=O)(=O)N(c1ccc([N+](=O)[O-])cc1Oc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C13H12N2O8S2.CH5N/c1-24(18,19)15(25(20,21)22)12-8-7-10(14(16)17)9-13(12)23-11-5-3-2-4-6-11;1-2/h2-9H,1H3,(H,20,21,22);2H2,1H3 |
| InChIKey | NUQSIZGTYQQSBT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 170.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|