About 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide
2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide (PubChem CID 11329271) has the molecular formula C22H20N2O9S
and a molecular weight of 488.47 g/mol. Its IUPAC name is 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide.
Molecular Properties
| Compound Name | 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide |
| PubChem CID | 11329271 |
| Molecular Formula | C22H20N2O9S |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1Oc1ccccc1 |
| InChI | InChI=1S/C13H12N2O5S.C9H8O4/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11;1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-9,14H,1H3;2-5H,1H3,(H,11,12) |
| InChIKey | BINWRRXLPWDQEI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide?
The IUPAC name of 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide (CID 11329271) is 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide.
What is the SMILES notation for 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide?
The canonical SMILES for 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide is CC(=O)Oc1ccccc1C(=O)O.CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1Oc1ccccc1.
What is the InChIKey of 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide?
The InChIKey is BINWRRXLPWDQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O5S.C9H8O4/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11;1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-9,14H,1H3;2-5H,1H3,(H,11,12).
What are the key properties of 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide?
2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide has a molecular weight of 488.47 g/mol, XLogP of 4.07, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxybenzoic acid;N-(4-nitro-2-phenoxyphenyl)methanesulfonamide is sourced from PubChem (CID 11329271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).