C12H13N3O13 — CID 87410519
2-acetyloxybenzoic acid;1,3-dinitrooxypropan-2-yl nitrate (PubChem CID 87410519) has the molecular formula C12H13N3O13 and a molecular weight of 407.24 g/mol. Its IUPAC name is 2-acetyloxybenzoic acid;1,3-dinitrooxypropan-2-yl nitrate.
| Compound Name | 2-acetyloxybenzoic acid;1,3-dinitrooxypropan-2-yl nitrate |
|---|---|
| PubChem CID | 87410519 |
| Molecular Formula | C12H13N3O13 |
| Molecular Weight | 407.24 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 2-acetyloxybenzoic acid;1,3-dinitrooxypropan-2-yl nitrate |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.O=[N+]([O-])OCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C9H8O4.C3H5N3O9/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;7-4(8)13-1-3(15-6(11)12)2-14-5(9)10/h2-5H,1H3,(H,11,12);3H,1-2H2 |
| InChIKey | WKPWWLYIBRVRMW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 220.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|