C13H15N2O10+ — CID 89361795
[6-(2-carboxyphenoxy)-1-nitrooxy-6-oxohexan-2-yl]oxy-hydroxy-oxoazanium (PubChem CID 89361795) has the molecular formula C13H15N2O10+ and a molecular weight of 359.27 g/mol. Its IUPAC name is [6-(2-carboxyphenoxy)-1-nitrooxy-6-oxohexan-2-yl]oxy-hydroxy-oxoazanium.
| Compound Name | [6-(2-carboxyphenoxy)-1-nitrooxy-6-oxohexan-2-yl]oxy-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 89361795 |
| Molecular Formula | C13H15N2O10+ |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | [6-(2-carboxyphenoxy)-1-nitrooxy-6-oxohexan-2-yl]oxy-hydroxy-oxoazanium |
| SMILES | O=C(CCCC(CO[N+](=O)[O-])O[N+](=O)O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C13H14N2O10/c16-12(24-11-6-2-1-5-10(11)13(17)18)7-3-4-9(25-15(21)22)8-23-14(19)20/h1-2,5-6,9H,3-4,7-8H2,(H-,17,18,21,22)/p+1 |
| InChIKey | ONZKWPXFLMXPJP-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 165.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|