C36H40N2O22 — CID 58083681
[2-[2-[2-[2-[2-[2-(6-nitrooxyhexanoyloxy)benzoyl]oxyacetyl]oxyacetyl]oxyethoxy]-2-oxoethoxy]-2-oxoethyl] 2-(6-nitrooxyhexanoyloxy)benzoate (PubChem CID 58083681) has the molecular formula C36H40N2O22 and a molecular weight of 852.71 g/mol. Its IUPAC name is [2-[2-[2-[2-[2-[2-(6-nitrooxyhexanoyloxy)benzoyl]oxyacetyl]oxyacetyl]oxyethoxy]-2-oxoethoxy]-2-oxoethyl] 2-(6-nitrooxyhexanoyloxy)benzoate.
| Compound Name | [2-[2-[2-[2-[2-[2-(6-nitrooxyhexanoyloxy)benzoyl]oxyacetyl]oxyacetyl]oxyethoxy]-2-oxoethoxy]-2-oxoethyl] 2-(6-nitrooxyhexanoyloxy)benzoate |
|---|---|
| PubChem CID | 58083681 |
| Molecular Formula | C36H40N2O22 |
| Molecular Weight | 852.71 g/mol |
| Exact Mass | 852.21 |
| IUPAC Name | [2-[2-[2-[2-[2-[2-(6-nitrooxyhexanoyloxy)benzoyl]oxyacetyl]oxyacetyl]oxyethoxy]-2-oxoethoxy]-2-oxoethyl] 2-(6-nitrooxyhexanoyloxy)benzoate |
| SMILES | O=C(COC(=O)COC(=O)c1ccccc1OC(=O)CCCCCO[N+](=O)[O-])OCCOC(=O)COC(=O)COC(=O)c1ccccc1OC(=O)CCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C36H40N2O22/c39-29(15-3-1-9-17-57-37(47)48)59-27-13-7-5-11-25(27)35(45)55-23-33(43)53-21-31(41)51-19-20-52-32(42)22-54-34(44)24-56-36(46)26-12-6-8-14-28(26)60-30(40)16-4-2-10-18-58-38(49)50/h5-8,11-14H,1-4,9-10,15-24H2 |
| InChIKey | PLGJBTJLJOULKN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 315.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.71 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|