C34H37NO19 — CID 70671082
3-O-[2-[2-[2-(4-nitrooxybutoxy)-2-oxoethoxy]carbonylphenoxy]-2-oxoethyl] 1-O-[2-oxo-2-[2-(2-oxo-2-pentoxyethoxy)carbonylphenoxy]ethyl] propanedioate (PubChem CID 70671082) has the molecular formula C34H37NO19 and a molecular weight of 763.66 g/mol. Its IUPAC name is 3-O-[2-[2-[2-(4-nitrooxybutoxy)-2-oxoethoxy]carbonylphenoxy]-2-oxoethyl] 1-O-[2-oxo-2-[2-(2-oxo-2-pentoxyethoxy)carbonylphenoxy]ethyl] propanedioate.
| Compound Name | 3-O-[2-[2-[2-(4-nitrooxybutoxy)-2-oxoethoxy]carbonylphenoxy]-2-oxoethyl] 1-O-[2-oxo-2-[2-(2-oxo-2-pentoxyethoxy)carbonylphenoxy]ethyl] propanedioate |
|---|---|
| PubChem CID | 70671082 |
| Molecular Formula | C34H37NO19 |
| Molecular Weight | 763.66 g/mol |
| Exact Mass | 763.20 |
| IUPAC Name | 3-O-[2-[2-[2-(4-nitrooxybutoxy)-2-oxoethoxy]carbonylphenoxy]-2-oxoethyl] 1-O-[2-oxo-2-[2-(2-oxo-2-pentoxyethoxy)carbonylphenoxy]ethyl] propanedioate |
| SMILES | CCCCCOC(=O)COC(=O)c1ccccc1OC(=O)COC(=O)CC(=O)OCC(=O)Oc1ccccc1C(=O)OCC(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C34H37NO19/c1-2-3-8-15-46-29(38)19-50-33(42)23-11-4-6-13-25(23)53-31(40)21-48-27(36)18-28(37)49-22-32(41)54-26-14-7-5-12-24(26)34(43)51-20-30(39)47-16-9-10-17-52-35(44)45/h4-7,11-14H,2-3,8-10,15-22H2,1H3 |
| InChIKey | VRHUHYPESSLBAI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 262.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.66 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|