C30H32BrN3O21 — CID 159740220
[2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(2-bromoacetyl)oxybenzoate;[2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(2-nitrooxyacetyl)oxybenzoate (PubChem CID 159740220) has the molecular formula C30H32BrN3O21 and a molecular weight of 850.49 g/mol. Its IUPAC name is [2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(2-bromoacetyl)oxybenzoate;[2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(2-nitrooxyacetyl)oxybenzoate.
| Compound Name | [2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(2-bromoacetyl)oxybenzoate;[2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(2-nitrooxyacetyl)oxybenzoate |
|---|---|
| PubChem CID | 159740220 |
| Molecular Formula | C30H32BrN3O21 |
| Molecular Weight | 850.49 g/mol |
| Exact Mass | 849.07 |
| IUPAC Name | [2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(2-bromoacetyl)oxybenzoate;[2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(2-nitrooxyacetyl)oxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1OC(=O)CBr)OCCCCO[N+](=O)[O-].O=C(COC(=O)c1ccccc1OC(=O)CO[N+](=O)[O-])OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C15H16BrNO9.C15H16N2O12/c16-9-13(18)26-12-6-2-1-5-11(12)15(20)24-10-14(19)23-7-3-4-8-25-17(21)22;18-13(25-7-3-4-8-27-16(21)22)9-26-15(20)11-5-1-2-6-12(11)29-14(19)10-28-17(23)24/h1-2,5-6H,3-4,7-10H2;1-2,5-6H,3-4,7-10H2 |
| InChIKey | NCJABINTSXDIHJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 314.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|