About [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate
[2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 58083667) has the molecular formula C13H15BrO5
and a molecular weight of 331.16 g/mol. Its IUPAC name is [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate.
Molecular Properties
| Compound Name | [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate |
| PubChem CID | 58083667 |
| Molecular Formula | C13H15BrO5 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1O)OCCCCBr |
| InChI | InChI=1S/C13H15BrO5/c14-7-3-4-8-18-12(16)9-19-13(17)10-5-1-2-6-11(10)15/h1-2,5-6,15H,3-4,7-9H2 |
| InChIKey | HMEWOGHVRCOUOG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate?
The IUPAC name of [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate (CID 58083667) is [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate.
What is the SMILES notation for [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate?
The canonical SMILES for [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate is O=C(COC(=O)c1ccccc1O)OCCCCBr.
What is the InChIKey of [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate?
The InChIKey is HMEWOGHVRCOUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrO5/c14-7-3-4-8-18-12(16)9-19-13(17)10-5-1-2-6-11(10)15/h1-2,5-6,15H,3-4,7-9H2.
What are the key properties of [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate?
[2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate has a molecular weight of 331.16 g/mol, XLogP of 2.27, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromobutoxy)-2-oxoethyl] 2-hydroxybenzoate is sourced from PubChem (CID 58083667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).