C21H22BrNO9 — CID 58083677
[2-(4-nitrooxybutoxy)-2-oxoethyl] 2-[6-(2-bromoacetyl)oxynaphthalen-2-yl]propanoate (PubChem CID 58083677) has the molecular formula C21H22BrNO9 and a molecular weight of 512.31 g/mol. Its IUPAC name is [2-(4-nitrooxybutoxy)-2-oxoethyl] 2-[6-(2-bromoacetyl)oxynaphthalen-2-yl]propanoate.
| Compound Name | [2-(4-nitrooxybutoxy)-2-oxoethyl] 2-[6-(2-bromoacetyl)oxynaphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 58083677 |
| Molecular Formula | C21H22BrNO9 |
| Molecular Weight | 512.31 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | [2-(4-nitrooxybutoxy)-2-oxoethyl] 2-[6-(2-bromoacetyl)oxynaphthalen-2-yl]propanoate |
| SMILES | CC(C(=O)OCC(=O)OCCCCO[N+](=O)[O-])c1ccc2cc(OC(=O)CBr)ccc2c1 |
| InChI | InChI=1S/C21H22BrNO9/c1-14(21(26)30-13-20(25)29-8-2-3-9-31-23(27)28)15-4-5-17-11-18(32-19(24)12-22)7-6-16(17)10-15/h4-7,10-11,14H,2-3,8-9,12-13H2,1H3 |
| InChIKey | WNOZLGNXLZKCEW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|