C17H17NO7 — CID 89407344
2-[6-(4-nitrooxybutanoyloxy)naphthalen-2-yl]propanoic acid (PubChem CID 89407344) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is 2-[6-(4-nitrooxybutanoyloxy)naphthalen-2-yl]propanoic acid.
| Compound Name | 2-[6-(4-nitrooxybutanoyloxy)naphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 89407344 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-[6-(4-nitrooxybutanoyloxy)naphthalen-2-yl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc2cc(OC(=O)CCCO[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C17H17NO7/c1-11(17(20)21)12-4-5-14-10-15(7-6-13(14)9-12)25-16(19)3-2-8-24-18(22)23/h4-7,9-11H,2-3,8H2,1H3,(H,20,21) |
| InChIKey | JNKLYZUGMRSRMV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|