About (4-sulfamoylphenyl) 4-nitrooxybutanoate
(4-sulfamoylphenyl) 4-nitrooxybutanoate (PubChem CID 69266223) has the molecular formula C10H12N2O7S
and a molecular weight of 304.28 g/mol. Its IUPAC name is (4-sulfamoylphenyl) 4-nitrooxybutanoate.
Molecular Properties
| Compound Name | (4-sulfamoylphenyl) 4-nitrooxybutanoate |
| PubChem CID | 69266223 |
| Molecular Formula | C10H12N2O7S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (4-sulfamoylphenyl) 4-nitrooxybutanoate |
| SMILES | NS(=O)(=O)c1ccc(OC(=O)CCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H12N2O7S/c11-20(16,17)9-5-3-8(4-6-9)19-10(13)2-1-7-18-12(14)15/h3-6H,1-2,7H2,(H2,11,16,17) |
| InChIKey | GCVAUNSHVNMZNP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-sulfamoylphenyl) 4-nitrooxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-sulfamoylphenyl) 4-nitrooxybutanoate?
The IUPAC name of (4-sulfamoylphenyl) 4-nitrooxybutanoate (CID 69266223) is (4-sulfamoylphenyl) 4-nitrooxybutanoate.
What is the SMILES notation for (4-sulfamoylphenyl) 4-nitrooxybutanoate?
The canonical SMILES for (4-sulfamoylphenyl) 4-nitrooxybutanoate is NS(=O)(=O)c1ccc(OC(=O)CCCO[N+](=O)[O-])cc1.
What is the InChIKey of (4-sulfamoylphenyl) 4-nitrooxybutanoate?
The InChIKey is GCVAUNSHVNMZNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O7S/c11-20(16,17)9-5-3-8(4-6-9)19-10(13)2-1-7-18-12(14)15/h3-6H,1-2,7H2,(H2,11,16,17).
What are the key properties of (4-sulfamoylphenyl) 4-nitrooxybutanoate?
(4-sulfamoylphenyl) 4-nitrooxybutanoate has a molecular weight of 304.28 g/mol, XLogP of 0.23, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-sulfamoylphenyl) 4-nitrooxybutanoate is sourced from PubChem (CID 69266223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).