About (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate
(3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate (PubChem CID 145476913) has the molecular formula C13H15NO6
and a molecular weight of 281.26 g/mol. Its IUPAC name is (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate.
Molecular Properties
| Compound Name | (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate |
| PubChem CID | 145476913 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate |
| SMILES | C=Cc1cc(OC(=O)CCCCO[N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C13H15NO6/c1-2-10-9-11(6-7-12(10)15)20-13(16)5-3-4-8-19-14(17)18/h2,6-7,9,15H,1,3-5,8H2 |
| InChIKey | PNGQSRAHMRUYEU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate?
The IUPAC name of (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate (CID 145476913) is (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate.
What is the SMILES notation for (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate?
The canonical SMILES for (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate is C=Cc1cc(OC(=O)CCCCO[N+](=O)[O-])ccc1O.
What is the InChIKey of (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate?
The InChIKey is PNGQSRAHMRUYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO6/c1-2-10-9-11(6-7-12(10)15)20-13(16)5-3-4-8-19-14(17)18/h2,6-7,9,15H,1,3-5,8H2.
What are the key properties of (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate?
(3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate has a molecular weight of 281.26 g/mol, XLogP of 2.32, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethenyl-4-hydroxyphenyl) 5-nitrooxypentanoate is sourced from PubChem (CID 145476913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).