About [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate
[4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate (PubChem CID 59445494) has the molecular formula C27H28N2O12
and a molecular weight of 572.52 g/mol. Its IUPAC name is [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate.
Molecular Properties
| Compound Name | [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate |
| PubChem CID | 59445494 |
| Molecular Formula | C27H28N2O12 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate |
| SMILES | O=C(CCCCCO[N+](=O)[O-])Oc1ccc(-c2coc3cc(OC(=O)CCCCCO[N+](=O)[O-])ccc3c2=O)cc1 |
| InChI | InChI=1S/C27H28N2O12/c30-25(7-3-1-5-15-38-28(33)34)40-20-11-9-19(10-12-20)23-18-37-24-17-21(13-14-22(24)27(23)32)41-26(31)8-4-2-6-16-39-29(35)36/h9-14,17-18H,1-8,15-16H2 |
| InChIKey | VWCBMSQXQZLYQB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 187.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate?
The IUPAC name of [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate (CID 59445494) is [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate.
What is the SMILES notation for [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate?
The canonical SMILES for [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate is O=C(CCCCCO[N+](=O)[O-])Oc1ccc(-c2coc3cc(OC(=O)CCCCCO[N+](=O)[O-])ccc3c2=O)cc1.
What is the InChIKey of [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate?
The InChIKey is VWCBMSQXQZLYQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N2O12/c30-25(7-3-1-5-15-38-28(33)34)40-20-11-9-19(10-12-20)23-18-37-24-17-21(13-14-22(24)27(23)32)41-26(31)8-4-2-6-16-39-29(35)36/h9-14,17-18H,1-8,15-16H2.
What are the key properties of [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate?
[4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate has a molecular weight of 572.52 g/mol, XLogP of 4.81, 17 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[7-(6-nitrooxyhexanoyloxy)-4-oxochromen-3-yl]phenyl] 6-nitrooxyhexanoate is sourced from PubChem (CID 59445494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).