C29H26FNO6 — CID 5195200
[3-(4-fluorophenyl)-4-oxochromen-7-yl] 6-[(2-phenoxyacetyl)amino]hexanoate (PubChem CID 5195200) has the molecular formula C29H26FNO6 and a molecular weight of 503.53 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-4-oxochromen-7-yl] 6-[(2-phenoxyacetyl)amino]hexanoate.
| Compound Name | [3-(4-fluorophenyl)-4-oxochromen-7-yl] 6-[(2-phenoxyacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 5195200 |
| Molecular Formula | C29H26FNO6 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | [3-(4-fluorophenyl)-4-oxochromen-7-yl] 6-[(2-phenoxyacetyl)amino]hexanoate |
| SMILES | O=C(COc1ccccc1)NCCCCCC(=O)Oc1ccc2c(=O)c(-c3ccc(F)cc3)coc2c1 |
| InChI | InChI=1S/C29H26FNO6/c30-21-12-10-20(11-13-21)25-18-36-26-17-23(14-15-24(26)29(25)34)37-28(33)9-5-2-6-16-31-27(32)19-35-22-7-3-1-4-8-22/h1,3-4,7-8,10-15,17-18H,2,5-6,9,16,19H2,(H,31,32) |
| InChIKey | QUIINRZDLFHQEF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|