C14H17NO9S2 — CID 90323498
2-methylsulfonylsulfanylethyl 2-(4-nitrooxybutanoyloxy)benzoate (PubChem CID 90323498) has the molecular formula C14H17NO9S2 and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-methylsulfonylsulfanylethyl 2-(4-nitrooxybutanoyloxy)benzoate.
| Compound Name | 2-methylsulfonylsulfanylethyl 2-(4-nitrooxybutanoyloxy)benzoate |
|---|---|
| PubChem CID | 90323498 |
| Molecular Formula | C14H17NO9S2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-methylsulfonylsulfanylethyl 2-(4-nitrooxybutanoyloxy)benzoate |
| SMILES | CS(=O)(=O)SCCOC(=O)c1ccccc1OC(=O)CCCO[N+](=O)[O-] |
| InChI | InChI=1S/C14H17NO9S2/c1-26(20,21)25-10-9-22-14(17)11-5-2-3-6-12(11)24-13(16)7-4-8-23-15(18)19/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | YYEZWYDBBWQCAE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 139.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|