C21H23NO15 — CID 46913438
[2-[2-[2-[2-(4-nitrooxybutoxy)-2-oxoethoxy]-2-oxoethoxy]-2-oxoethoxy]-2-oxoethyl] 2-acetyloxybenzoate (PubChem CID 46913438) has the molecular formula C21H23NO15 and a molecular weight of 529.41 g/mol. Its IUPAC name is [2-[2-[2-[2-(4-nitrooxybutoxy)-2-oxoethoxy]-2-oxoethoxy]-2-oxoethoxy]-2-oxoethyl] 2-acetyloxybenzoate.
| Compound Name | [2-[2-[2-[2-(4-nitrooxybutoxy)-2-oxoethoxy]-2-oxoethoxy]-2-oxoethoxy]-2-oxoethyl] 2-acetyloxybenzoate |
|---|---|
| PubChem CID | 46913438 |
| Molecular Formula | C21H23NO15 |
| Molecular Weight | 529.41 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | [2-[2-[2-[2-(4-nitrooxybutoxy)-2-oxoethoxy]-2-oxoethoxy]-2-oxoethoxy]-2-oxoethyl] 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OCC(=O)OCC(=O)OCC(=O)OCC(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C21H23NO15/c1-14(23)37-16-7-3-2-6-15(16)21(28)35-13-20(27)34-12-19(26)33-11-18(25)32-10-17(24)31-8-4-5-9-36-22(29)30/h2-3,6-7H,4-5,8-13H2,1H3 |
| InChIKey | ZLRVYTIVIFOGRB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 210.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.41 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|