About hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate
hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate (PubChem CID 158124338) has the molecular formula C16H15ClN2O8
and a molecular weight of 398.76 g/mol. Its IUPAC name is hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate |
| PubChem CID | 158124338 |
| Molecular Formula | C16H15ClN2O8 |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OCc1cccc(CO[N+](=O)[O-])n1.OCl |
| InChI | InChI=1S/C16H14N2O7.ClHO/c1-11(19)25-15-8-3-2-7-14(15)16(20)23-9-12-5-4-6-13(17-12)10-24-18(21)22;1-2/h2-8H,9-10H2,1H3;2H |
| InChIKey | FRYZLZPJRHNCEN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate?
The IUPAC name of hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate (CID 158124338) is hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate.
What is the SMILES notation for hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate?
The canonical SMILES for hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)OCc1cccc(CO[N+](=O)[O-])n1.OCl.
What is the InChIKey of hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate?
The InChIKey is FRYZLZPJRHNCEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O7.ClHO/c1-11(19)25-15-8-3-2-7-14(15)16(20)23-9-12-5-4-6-13(17-12)10-24-18(21)22;1-2/h2-8H,9-10H2,1H3;2H.
What are the key properties of hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate?
hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate has a molecular weight of 398.76 g/mol, XLogP of 2.20, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for hypochlorous acid;[6-(nitrooxymethyl)-2-pyridinyl]methyl 2-acetyloxybenzoate is sourced from PubChem (CID 158124338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).