C23H21NO11 — CID 44542788
[(3R,3aR,6S,6aR)-6-(2-acetyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-(nitrooxymethyl)benzoate (PubChem CID 44542788) has the molecular formula C23H21NO11 and a molecular weight of 487.42 g/mol. Its IUPAC name is [(3R,3aR,6S,6aR)-6-(2-acetyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-(nitrooxymethyl)benzoate.
| Compound Name | [(3R,3aR,6S,6aR)-6-(2-acetyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-(nitrooxymethyl)benzoate |
|---|---|
| PubChem CID | 44542788 |
| Molecular Formula | C23H21NO11 |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | [(3R,3aR,6S,6aR)-6-(2-acetyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-(nitrooxymethyl)benzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)c1ccccc1CO[N+](=O)[O-] |
| InChI | InChI=1S/C23H21NO11/c1-13(25)33-17-9-5-4-8-16(17)23(27)35-19-12-31-20-18(11-30-21(19)20)34-22(26)15-7-3-2-6-14(15)10-32-24(28)29/h2-9,18-21H,10-12H2,1H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | VPWOJBINIAXBGB-PLACYPQZSA-N |
| XLogP | 1.87 |
| TPSA | 149.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|