C22H21NO8 — CID 123371705
[3-(2-oxo-1-pyridin-3-ylethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-acetyloxybenzoate (PubChem CID 123371705) has the molecular formula C22H21NO8 and a molecular weight of 427.41 g/mol. Its IUPAC name is [3-(2-oxo-1-pyridin-3-ylethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-acetyloxybenzoate.
| Compound Name | [3-(2-oxo-1-pyridin-3-ylethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-acetyloxybenzoate |
|---|---|
| PubChem CID | 123371705 |
| Molecular Formula | C22H21NO8 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [3-(2-oxo-1-pyridin-3-ylethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OC1COC2C(OC(C=O)c3cccnc3)COC12 |
| InChI | InChI=1S/C22H21NO8/c1-13(25)29-16-7-3-2-6-15(16)22(26)31-19-12-28-20-18(11-27-21(19)20)30-17(10-24)14-5-4-8-23-9-14/h2-10,17-21H,11-12H2,1H3 |
| InChIKey | XAYZLNTUJISWOP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|