C23H23NO11 — CID 88973180
[(3R,3aR,6S,6aR)-6-(2-acetyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-[(dihydroxyamino)oxymethyl]benzoate (PubChem CID 88973180) has the molecular formula C23H23NO11 and a molecular weight of 489.43 g/mol. Its IUPAC name is [(3R,3aR,6S,6aR)-6-(2-acetyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-[(dihydroxyamino)oxymethyl]benzoate.
| Compound Name | [(3R,3aR,6S,6aR)-6-(2-acetyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-[(dihydroxyamino)oxymethyl]benzoate |
|---|---|
| PubChem CID | 88973180 |
| Molecular Formula | C23H23NO11 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | [(3R,3aR,6S,6aR)-6-(2-acetyloxybenzoyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-[(dihydroxyamino)oxymethyl]benzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)c1ccccc1CON(O)O |
| InChI | InChI=1S/C23H23NO11/c1-13(25)33-17-9-5-4-8-16(17)23(27)35-19-12-31-20-18(11-30-21(19)20)34-22(26)15-7-3-2-6-14(15)10-32-24(28)29/h2-9,18-21,28-29H,10-12H2,1H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | UQZQNJCLLWHZRY-PLACYPQZSA-N |
| XLogP | 1.67 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|