C15H15O6Y- — CID 58158800
[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-id-6-yl] 2-acetyloxybenzoate;yttrium (PubChem CID 58158800) has the molecular formula C15H15O6Y- and a molecular weight of 380.19 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-id-6-yl] 2-acetyloxybenzoate;yttrium.
| Compound Name | [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-id-6-yl] 2-acetyloxybenzoate;yttrium |
|---|---|
| PubChem CID | 58158800 |
| Molecular Formula | C15H15O6Y- |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-id-6-yl] 2-acetyloxybenzoate;yttrium |
| SMILES | CC(=O)Oc1ccccc1C(=O)OC1CO[C@@H]2[CH-]CO[C@H]12.[Y] |
| InChI | InChI=1S/C15H15O6.Y/c1-9(16)20-11-5-3-2-4-10(11)15(17)21-13-8-19-12-6-7-18-14(12)13;/h2-6,12-14H,7-8H2,1H3;/q-1;/t12-,13?,14+;/m1./s1 |
| InChIKey | CCKRMWNBTIZAND-VBFQVJHPSA-N |
| XLogP | 1.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|