About [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride
[2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride (PubChem CID 68926087) has the molecular formula C14H13ClN2O6
and a molecular weight of 340.72 g/mol. Its IUPAC name is [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride |
| PubChem CID | 68926087 |
| Molecular Formula | C14H13ClN2O6 |
| Molecular Weight | 340.72 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride |
| SMILES | Cc1nc(CO[N+](=O)[O-])ccc1OC(=O)c1ccccc1O.Cl |
| InChI | InChI=1S/C14H12N2O6.ClH/c1-9-13(7-6-10(15-9)8-21-16(19)20)22-14(18)11-4-2-3-5-12(11)17;/h2-7,17H,8H2,1H3;1H |
| InChIKey | PHPTZRZUFSLRQO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.72 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride?
The IUPAC name of [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride (CID 68926087) is [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride.
What is the SMILES notation for [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride?
The canonical SMILES for [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride is Cc1nc(CO[N+](=O)[O-])ccc1OC(=O)c1ccccc1O.Cl.
What is the InChIKey of [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride?
The InChIKey is PHPTZRZUFSLRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O6.ClH/c1-9-13(7-6-10(15-9)8-21-16(19)20)22-14(18)11-4-2-3-5-12(11)17;/h2-7,17H,8H2,1H3;1H.
What are the key properties of [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride?
[2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride has a molecular weight of 340.72 g/mol, XLogP of 2.44, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-6-(nitrooxymethyl)-3-pyridinyl] 2-hydroxybenzoate;hydrochloride is sourced from PubChem (CID 68926087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).