C21H21NO10 — CID 69383457
[4-[(E)-2-hydroxy-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-hydroxybenzoate (PubChem CID 69383457) has the molecular formula C21H21NO10 and a molecular weight of 447.40 g/mol. Its IUPAC name is [4-[(E)-2-hydroxy-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-hydroxybenzoate.
| Compound Name | [4-[(E)-2-hydroxy-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 69383457 |
| Molecular Formula | C21H21NO10 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | [4-[(E)-2-hydroxy-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-hydroxybenzoate |
| SMILES | COc1cc(/C=C(/O)C(=O)OCCCCO[N+](=O)[O-])ccc1OC(=O)c1ccccc1O |
| InChI | InChI=1S/C21H21NO10/c1-29-19-13-14(12-17(24)21(26)30-10-4-5-11-31-22(27)28)8-9-18(19)32-20(25)15-6-2-3-7-16(15)23/h2-3,6-9,12-13,23-24H,4-5,10-11H2,1H3/b17-12+ |
| InChIKey | ZAJFRVOQCPEGLY-SFQUDFHCSA-N |
| XLogP | 3.05 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|