C21H26O3 — CID 18984257
[2-(2,4,4-trimethylpentan-2-yl)phenyl] 2-hydroxybenzoate (PubChem CID 18984257) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is [2-(2,4,4-trimethylpentan-2-yl)phenyl] 2-hydroxybenzoate.
| Compound Name | [2-(2,4,4-trimethylpentan-2-yl)phenyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 18984257 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [2-(2,4,4-trimethylpentan-2-yl)phenyl] 2-hydroxybenzoate |
| SMILES | CC(C)(C)CC(C)(C)c1ccccc1OC(=O)c1ccccc1O |
| InChI | InChI=1S/C21H26O3/c1-20(2,3)14-21(4,5)16-11-7-9-13-18(16)24-19(23)15-10-6-8-12-17(15)22/h6-13,22H,14H2,1-5H3 |
| InChIKey | VDLMSJJXZBGABQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|