About (2-propan-2-ylphenyl) 2-hydroxybenzoate
(2-propan-2-ylphenyl) 2-hydroxybenzoate (PubChem CID 22898697) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is (2-propan-2-ylphenyl) 2-hydroxybenzoate.
Molecular Properties
| Compound Name | (2-propan-2-ylphenyl) 2-hydroxybenzoate |
| PubChem CID | 22898697 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2-propan-2-ylphenyl) 2-hydroxybenzoate |
| SMILES | CC(C)c1ccccc1OC(=O)c1ccccc1O |
| InChI | InChI=1S/C16H16O3/c1-11(2)12-7-4-6-10-15(12)19-16(18)13-8-3-5-9-14(13)17/h3-11,17H,1-2H3 |
| InChIKey | CAZLXOLEEHRDPO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-propan-2-ylphenyl) 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propan-2-ylphenyl) 2-hydroxybenzoate?
The IUPAC name of (2-propan-2-ylphenyl) 2-hydroxybenzoate (CID 22898697) is (2-propan-2-ylphenyl) 2-hydroxybenzoate.
What is the SMILES notation for (2-propan-2-ylphenyl) 2-hydroxybenzoate?
The canonical SMILES for (2-propan-2-ylphenyl) 2-hydroxybenzoate is CC(C)c1ccccc1OC(=O)c1ccccc1O.
What is the InChIKey of (2-propan-2-ylphenyl) 2-hydroxybenzoate?
The InChIKey is CAZLXOLEEHRDPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3/c1-11(2)12-7-4-6-10-15(12)19-16(18)13-8-3-5-9-14(13)17/h3-11,17H,1-2H3.
What are the key properties of (2-propan-2-ylphenyl) 2-hydroxybenzoate?
(2-propan-2-ylphenyl) 2-hydroxybenzoate has a molecular weight of 256.30 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propan-2-ylphenyl) 2-hydroxybenzoate is sourced from PubChem (CID 22898697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).