About (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol
(5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol (PubChem CID 157139383) has the molecular formula C35H34O5
and a molecular weight of 534.65 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol |
| PubChem CID | 157139383 |
| Molecular Formula | C35H34O5 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)c2ccccc2O)c1.Oc1ccccc1.Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C17H18O3.C12H10O.C6H6O/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;7-6-4-2-1-3-5-6/h4-11,18H,1-3H3;1-9,13H;1-5,7H |
| InChIKey | AJZYWDASGNNRDI-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol?
The IUPAC name of (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol (CID 157139383) is (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol.
What is the SMILES notation for (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol?
The canonical SMILES for (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol is Cc1ccc(C(C)C)c(OC(=O)c2ccccc2O)c1.Oc1ccccc1.Oc1ccccc1-c1ccccc1.
What is the InChIKey of (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol?
The InChIKey is AJZYWDASGNNRDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3.C12H10O.C6H6O/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;7-6-4-2-1-3-5-6/h4-11,18H,1-3H3;1-9,13H;1-5,7H.
What are the key properties of (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol?
(5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol has a molecular weight of 534.65 g/mol, XLogP of 8.49, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylphenyl) 2-hydroxybenzoate;phenol;2-phenylphenol is sourced from PubChem (CID 157139383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).