C32H32O5 — CID 11081570
(5-methyl-2-propan-2-ylphenyl) 3-methoxy-4,5-bis(phenylmethoxy)benzoate (PubChem CID 11081570) has the molecular formula C32H32O5 and a molecular weight of 496.60 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 3-methoxy-4,5-bis(phenylmethoxy)benzoate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 3-methoxy-4,5-bis(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 11081570 |
| Molecular Formula | C32H32O5 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 3-methoxy-4,5-bis(phenylmethoxy)benzoate |
| SMILES | COc1cc(C(=O)Oc2cc(C)ccc2C(C)C)cc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C32H32O5/c1-22(2)27-16-15-23(3)17-28(27)37-32(33)26-18-29(34-4)31(36-21-25-13-9-6-10-14-25)30(19-26)35-20-24-11-7-5-8-12-24/h5-19,22H,20-21H2,1-4H3 |
| InChIKey | JPZCTNRAZCXXRS-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|