C21H32O4 — CID 70537942
(E)-3-ethoxy-2-[2-(2,4,4-trimethylpentan-2-yl)phenoxy]pent-2-enoic acid (PubChem CID 70537942) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (E)-3-ethoxy-2-[2-(2,4,4-trimethylpentan-2-yl)phenoxy]pent-2-enoic acid.
| Compound Name | (E)-3-ethoxy-2-[2-(2,4,4-trimethylpentan-2-yl)phenoxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 70537942 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (E)-3-ethoxy-2-[2-(2,4,4-trimethylpentan-2-yl)phenoxy]pent-2-enoic acid |
| SMILES | CCO/C(CC)=C(/Oc1ccccc1C(C)(C)CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C21H32O4/c1-8-16(24-9-2)18(19(22)23)25-17-13-11-10-12-15(17)21(6,7)14-20(3,4)5/h10-13H,8-9,14H2,1-7H3,(H,22,23)/b18-16+ |
| InChIKey | IUNIRWZQFNQRPZ-FBMGVBCBSA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|