About 2-(2,4,4-trimethylpentan-2-yl)aniline
2-(2,4,4-trimethylpentan-2-yl)aniline (PubChem CID 67789986) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is 2-(2,4,4-trimethylpentan-2-yl)aniline.
Molecular Properties
| Compound Name | 2-(2,4,4-trimethylpentan-2-yl)aniline |
| PubChem CID | 67789986 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 2-(2,4,4-trimethylpentan-2-yl)aniline |
| SMILES | CC(C)(C)CC(C)(C)c1ccccc1N |
| InChI | InChI=1S/C14H23N/c1-13(2,3)10-14(4,5)11-8-6-7-9-12(11)15/h6-9H,10,15H2,1-5H3 |
| InChIKey | WFXFYOFFVKQYGM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4,4-trimethylpentan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,4-trimethylpentan-2-yl)aniline?
The IUPAC name of 2-(2,4,4-trimethylpentan-2-yl)aniline (CID 67789986) is 2-(2,4,4-trimethylpentan-2-yl)aniline.
What is the SMILES notation for 2-(2,4,4-trimethylpentan-2-yl)aniline?
The canonical SMILES for 2-(2,4,4-trimethylpentan-2-yl)aniline is CC(C)(C)CC(C)(C)c1ccccc1N.
What is the InChIKey of 2-(2,4,4-trimethylpentan-2-yl)aniline?
The InChIKey is WFXFYOFFVKQYGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N/c1-13(2,3)10-14(4,5)11-8-6-7-9-12(11)15/h6-9H,10,15H2,1-5H3.
What are the key properties of 2-(2,4,4-trimethylpentan-2-yl)aniline?
2-(2,4,4-trimethylpentan-2-yl)aniline has a molecular weight of 205.34 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,4-trimethylpentan-2-yl)aniline is sourced from PubChem (CID 67789986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).