About 2-tert-butylaniline
2-tert-butylaniline (PubChem CID 159041627) has the molecular formula C20H30N2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-tert-butylaniline.
Molecular Properties
| Compound Name | 2-tert-butylaniline |
| PubChem CID | 159041627 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2-tert-butylaniline |
| SMILES | CC(C)(C)c1ccccc1N.CC(C)(C)c1ccccc1N |
| InChI | InChI=1S/2C10H15N/c2*1-10(2,3)8-6-4-5-7-9(8)11/h2*4-7H,11H2,1-3H3 |
| InChIKey | JWCZEZHYRGUROL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylaniline?
The IUPAC name of 2-tert-butylaniline (CID 159041627) is 2-tert-butylaniline.
What is the SMILES notation for 2-tert-butylaniline?
The canonical SMILES for 2-tert-butylaniline is CC(C)(C)c1ccccc1N.CC(C)(C)c1ccccc1N.
What is the InChIKey of 2-tert-butylaniline?
The InChIKey is JWCZEZHYRGUROL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H15N/c2*1-10(2,3)8-6-4-5-7-9(8)11/h2*4-7H,11H2,1-3H3.
What are the key properties of 2-tert-butylaniline?
2-tert-butylaniline has a molecular weight of 298.47 g/mol, XLogP of 5.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylaniline is sourced from PubChem (CID 159041627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).