About 1-(2-aminophenyl)ethane-1,1-disulfonic acid
1-(2-aminophenyl)ethane-1,1-disulfonic acid (PubChem CID 87755630) has the molecular formula C8H11NO6S2
and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(2-aminophenyl)ethane-1,1-disulfonic acid.
Molecular Properties
| Compound Name | 1-(2-aminophenyl)ethane-1,1-disulfonic acid |
| PubChem CID | 87755630 |
| Molecular Formula | C8H11NO6S2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 1-(2-aminophenyl)ethane-1,1-disulfonic acid |
| SMILES | CC(c1ccccc1N)(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C8H11NO6S2/c1-8(16(10,11)12,17(13,14)15)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3,(H,10,11,12)(H,13,14,15) |
| InChIKey | JEQOSZJJDLUWAP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminophenyl)ethane-1,1-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminophenyl)ethane-1,1-disulfonic acid?
The IUPAC name of 1-(2-aminophenyl)ethane-1,1-disulfonic acid (CID 87755630) is 1-(2-aminophenyl)ethane-1,1-disulfonic acid.
What is the SMILES notation for 1-(2-aminophenyl)ethane-1,1-disulfonic acid?
The canonical SMILES for 1-(2-aminophenyl)ethane-1,1-disulfonic acid is CC(c1ccccc1N)(S(=O)(=O)O)S(=O)(=O)O.
What is the InChIKey of 1-(2-aminophenyl)ethane-1,1-disulfonic acid?
The InChIKey is JEQOSZJJDLUWAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO6S2/c1-8(16(10,11)12,17(13,14)15)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3,(H,10,11,12)(H,13,14,15).
What are the key properties of 1-(2-aminophenyl)ethane-1,1-disulfonic acid?
1-(2-aminophenyl)ethane-1,1-disulfonic acid has a molecular weight of 281.31 g/mol, XLogP of 0.22, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminophenyl)ethane-1,1-disulfonic acid is sourced from PubChem (CID 87755630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).