C8H11NO6S2 — CID 87755630
1-(2-aminophenyl)ethane-1,1-disulfonic acid (PubChem CID 87755630) has the molecular formula C8H11NO6S2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(2-aminophenyl)ethane-1,1-disulfonic acid.
| Compound Name | 1-(2-aminophenyl)ethane-1,1-disulfonic acid |
|---|---|
| PubChem CID | 87755630 |
| Molecular Formula | C8H11NO6S2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 1-(2-aminophenyl)ethane-1,1-disulfonic acid |
| SMILES | CC(c1ccccc1N)(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C8H11NO6S2/c1-8(16(10,11)12,17(13,14)15)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3,(H,10,11,12)(H,13,14,15) |
| InChIKey | JEQOSZJJDLUWAP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|