C20H26N2 — CID 88827442
phenyl-[2-(2,4,4-trimethylpentan-2-yl)phenyl]diazene (PubChem CID 88827442) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is phenyl-[2-(2,4,4-trimethylpentan-2-yl)phenyl]diazene.
| Compound Name | phenyl-[2-(2,4,4-trimethylpentan-2-yl)phenyl]diazene |
|---|---|
| PubChem CID | 88827442 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | phenyl-[2-(2,4,4-trimethylpentan-2-yl)phenyl]diazene |
| SMILES | CC(C)(C)CC(C)(C)c1ccccc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C20H26N2/c1-19(2,3)15-20(4,5)17-13-9-10-14-18(17)22-21-16-11-7-6-8-12-16/h6-14H,15H2,1-5H3/b22-21+ |
| InChIKey | YZEWQNNAKIZCIQ-QURGRASLSA-N |
| XLogP | 6.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|