C17H20N2 — CID 134551069
[4-(2,2-dimethylpropyl)phenyl]-phenyldiazene (PubChem CID 134551069) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is [4-(2,2-dimethylpropyl)phenyl]-phenyldiazene.
| Compound Name | [4-(2,2-dimethylpropyl)phenyl]-phenyldiazene |
|---|---|
| PubChem CID | 134551069 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | [4-(2,2-dimethylpropyl)phenyl]-phenyldiazene |
| SMILES | CC(C)(C)Cc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2/c1-17(2,3)13-14-9-11-16(12-10-14)19-18-15-7-5-4-6-8-15/h4-12H,13H2,1-3H3/b19-18+ |
| InChIKey | HKBJGSSZJXFHEZ-VHEBQXMUSA-N |
| XLogP | 5.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|