C22H38 — CID 19766935
1,2-bis(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 19766935) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is 1,2-bis(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 1,2-bis(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 19766935 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | 1,2-bis(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CC(C)(C)CC(C)(C)c1ccccc1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C22H38/c1-19(2,3)15-21(7,8)17-13-11-12-14-18(17)22(9,10)16-20(4,5)6/h11-14H,15-16H2,1-10H3 |
| InChIKey | TVQQEGXZKRIZNC-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |