C22H28O2S2 — CID 146309199
benzenecarbothioic S-acid;2-(2,4,4-trimethylpentan-2-yl)benzenecarbothioic S-acid (PubChem CID 146309199) has the molecular formula C22H28O2S2 and a molecular weight of 388.60 g/mol. Its IUPAC name is benzenecarbothioic S-acid;2-(2,4,4-trimethylpentan-2-yl)benzenecarbothioic S-acid.
| Compound Name | benzenecarbothioic S-acid;2-(2,4,4-trimethylpentan-2-yl)benzenecarbothioic S-acid |
|---|---|
| PubChem CID | 146309199 |
| Molecular Formula | C22H28O2S2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | benzenecarbothioic S-acid;2-(2,4,4-trimethylpentan-2-yl)benzenecarbothioic S-acid |
| SMILES | CC(C)(C)CC(C)(C)c1ccccc1C(=O)S.O=C(S)c1ccccc1 |
| InChI | InChI=1S/C15H22OS.C7H6OS/c1-14(2,3)10-15(4,5)12-9-7-6-8-11(12)13(16)17;8-7(9)6-4-2-1-3-5-6/h6-9H,10H2,1-5H3,(H,16,17);1-5H,(H,8,9) |
| InChIKey | TWWWCBRRPANQPF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|