About benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid
benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid (PubChem CID 87850676) has the molecular formula C14H11BrO2S2
and a molecular weight of 355.28 g/mol. Its IUPAC name is benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid.
Molecular Properties
| Compound Name | benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid |
| PubChem CID | 87850676 |
| Molecular Formula | C14H11BrO2S2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid |
| SMILES | O=C(S)c1ccccc1.O=C(S)c1ccccc1Br |
| InChI | InChI=1S/C7H5BrOS.C7H6OS/c8-6-4-2-1-3-5(6)7(9)10;8-7(9)6-4-2-1-3-5-6/h1-4H,(H,9,10);1-5H,(H,8,9) |
| InChIKey | MZPGXCCNHULOLB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid?
The IUPAC name of benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid (CID 87850676) is benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid.
What is the SMILES notation for benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid?
The canonical SMILES for benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid is O=C(S)c1ccccc1.O=C(S)c1ccccc1Br.
What is the InChIKey of benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid?
The InChIKey is MZPGXCCNHULOLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrOS.C7H6OS/c8-6-4-2-1-3-5(6)7(9)10;8-7(9)6-4-2-1-3-5-6/h1-4H,(H,9,10);1-5H,(H,8,9).
What are the key properties of benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid?
benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid has a molecular weight of 355.28 g/mol, XLogP of 4.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarbothioic S-acid;2-bromobenzenecarbothioic S-acid is sourced from PubChem (CID 87850676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).