C23H30O3 — CID 154510347
2-(1-phenylethoxy)-3-(2,4,4-trimethylpentan-2-yl)benzoic acid (PubChem CID 154510347) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-(1-phenylethoxy)-3-(2,4,4-trimethylpentan-2-yl)benzoic acid.
| Compound Name | 2-(1-phenylethoxy)-3-(2,4,4-trimethylpentan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 154510347 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-(1-phenylethoxy)-3-(2,4,4-trimethylpentan-2-yl)benzoic acid |
| SMILES | CC(Oc1c(C(=O)O)cccc1C(C)(C)CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H30O3/c1-16(17-11-8-7-9-12-17)26-20-18(21(24)25)13-10-14-19(20)23(5,6)15-22(2,3)4/h7-14,16H,15H2,1-6H3,(H,24,25) |
| InChIKey | HAIDYEKRXXWDPA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |