C30H44O6 — CID 88519141
2,3-bis(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol;phthalic acid (PubChem CID 88519141) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is 2,3-bis(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol;phthalic acid.
| Compound Name | 2,3-bis(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol;phthalic acid |
|---|---|
| PubChem CID | 88519141 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 2,3-bis(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol;phthalic acid |
| SMILES | CC(C)(C)CC(C)(C)c1c(O)ccc(O)c1C(C)(C)CC(C)(C)C.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C22H38O2.C8H6O4/c1-19(2,3)13-21(7,8)17-15(23)11-12-16(24)18(17)22(9,10)14-20(4,5)6;9-7(10)5-3-1-2-4-6(5)8(11)12/h11-12,23-24H,13-14H2,1-10H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | CLPWAZWUVHBICJ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|