C22H26O4 — CID 139838896
2-[4-hydroxy-3-(2,4,4-trimethylpentan-2-yl)benzoyl]benzoic acid (PubChem CID 139838896) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[4-hydroxy-3-(2,4,4-trimethylpentan-2-yl)benzoyl]benzoic acid.
| Compound Name | 2-[4-hydroxy-3-(2,4,4-trimethylpentan-2-yl)benzoyl]benzoic acid |
|---|---|
| PubChem CID | 139838896 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-[4-hydroxy-3-(2,4,4-trimethylpentan-2-yl)benzoyl]benzoic acid |
| SMILES | CC(C)(C)CC(C)(C)c1cc(C(=O)c2ccccc2C(=O)O)ccc1O |
| InChI | InChI=1S/C22H26O4/c1-21(2,3)13-22(4,5)17-12-14(10-11-18(17)23)19(24)15-8-6-7-9-16(15)20(25)26/h6-12,23H,13H2,1-5H3,(H,25,26) |
| InChIKey | UIMNYCMNGFRXID-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |