About (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate
(2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate (PubChem CID 10266892) has the molecular formula C14H14N4O4
and a molecular weight of 302.29 g/mol. Its IUPAC name is (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate |
| PubChem CID | 10266892 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OCc1cnc(N)nc1N |
| InChI | InChI=1S/C14H14N4O4/c1-8(19)22-11-5-3-2-4-10(11)13(20)21-7-9-6-17-14(16)18-12(9)15/h2-6H,7H2,1H3,(H4,15,16,17,18) |
| InChIKey | BYFHNKSEGVSFMG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate?
The IUPAC name of (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate (CID 10266892) is (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate.
What is the SMILES notation for (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate?
The canonical SMILES for (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)OCc1cnc(N)nc1N.
What is the InChIKey of (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate?
The InChIKey is BYFHNKSEGVSFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O4/c1-8(19)22-11-5-3-2-4-10(11)13(20)21-7-9-6-17-14(16)18-12(9)15/h2-6H,7H2,1H3,(H4,15,16,17,18).
What are the key properties of (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate?
(2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate has a molecular weight of 302.29 g/mol, XLogP of 0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-diaminopyrimidin-5-yl)methyl 2-acetyloxybenzoate is sourced from PubChem (CID 10266892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).