About 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate
3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate (PubChem CID 155388021) has the molecular formula C30H28BrO4P
and a molecular weight of 563.43 g/mol. Its IUPAC name is 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate |
| PubChem CID | 155388021 |
| Molecular Formula | C30H28BrO4P |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28BrO4P/c1-24(32)35-29-21-12-11-20-28(29)30(33)34-22-13-23-36(31,25-14-5-2-6-15-25,26-16-7-3-8-17-26)27-18-9-4-10-19-27/h2-12,14-21H,13,22-23H2,1H3 |
| InChIKey | AMEAYXNGQICBBC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate?
The IUPAC name of 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate (CID 155388021) is 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate.
What is the SMILES notation for 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate?
The canonical SMILES for 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)OCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate?
The InChIKey is AMEAYXNGQICBBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28BrO4P/c1-24(32)35-29-21-12-11-20-28(29)30(33)34-22-13-23-36(31,25-14-5-2-6-15-25,26-16-7-3-8-17-26)27-18-9-4-10-19-27/h2-12,14-21H,13,22-23H2,1H3.
What are the key properties of 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate?
3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate has a molecular weight of 563.43 g/mol, XLogP of 6.00, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bromo(triphenyl)-λ5-phosphanyl]propyl 2-acetyloxybenzoate is sourced from PubChem (CID 155388021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).