About [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate
[5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate (PubChem CID 153409082) has the molecular formula C32H32BrO4P
and a molecular weight of 591.48 g/mol. Its IUPAC name is [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate.
Molecular Properties
| Compound Name | [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate |
| PubChem CID | 153409082 |
| Molecular Formula | C32H32BrO4P |
| Molecular Weight | 591.48 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate |
| SMILES | CC(=O)C(CCCCOC(=O)c1ccccc1O)P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H32BrO4P/c1-25(34)31(23-13-14-24-37-32(36)29-21-11-12-22-30(29)35)38(33,26-15-5-2-6-16-26,27-17-7-3-8-18-27)28-19-9-4-10-20-28/h2-12,15-22,31,35H,13-14,23-24H2,1H3 |
| InChIKey | FWDBBTNVISKVTK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 591.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate?
The IUPAC name of [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate (CID 153409082) is [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate.
What is the SMILES notation for [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate?
The canonical SMILES for [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate is CC(=O)C(CCCCOC(=O)c1ccccc1O)P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate?
The InChIKey is FWDBBTNVISKVTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H32BrO4P/c1-25(34)31(23-13-14-24-37-32(36)29-21-11-12-22-30(29)35)38(33,26-15-5-2-6-16-26,27-17-7-3-8-18-27)28-19-9-4-10-20-28/h2-12,15-22,31,35H,13-14,23-24H2,1H3.
What are the key properties of [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate?
[5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate has a molecular weight of 591.48 g/mol, XLogP of 6.52, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[bromo(triphenyl)-λ5-phosphanyl]-6-oxoheptyl] 2-hydroxybenzoate is sourced from PubChem (CID 153409082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).