C36H40BrO4P — CID 153409083
[9-[bromo(triphenyl)-λ5-phosphanyl]-10-oxoundecyl] 2-hydroxybenzoate (PubChem CID 153409083) has the molecular formula C36H40BrO4P and a molecular weight of 647.59 g/mol. Its IUPAC name is [9-[bromo(triphenyl)-λ5-phosphanyl]-10-oxoundecyl] 2-hydroxybenzoate.
| Compound Name | [9-[bromo(triphenyl)-λ5-phosphanyl]-10-oxoundecyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 153409083 |
| Molecular Formula | C36H40BrO4P |
| Molecular Weight | 647.59 g/mol |
| Exact Mass | 646.18 |
| IUPAC Name | [9-[bromo(triphenyl)-λ5-phosphanyl]-10-oxoundecyl] 2-hydroxybenzoate |
| SMILES | CC(=O)C(CCCCCCCCOC(=O)c1ccccc1O)P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H40BrO4P/c1-29(38)35(27-15-4-2-3-5-18-28-41-36(40)33-25-16-17-26-34(33)39)42(37,30-19-9-6-10-20-30,31-21-11-7-12-22-31)32-23-13-8-14-24-32/h6-14,16-17,19-26,35,39H,2-5,15,18,27-28H2,1H3 |
| InChIKey | UJNYNJAMGQLFBP-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.59 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|