C14H18N2O6 — CID 69089144
[2-(5-nitrooxypentylcarbamoyl)phenyl] acetate (PubChem CID 69089144) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is [2-(5-nitrooxypentylcarbamoyl)phenyl] acetate.
| Compound Name | [2-(5-nitrooxypentylcarbamoyl)phenyl] acetate |
|---|---|
| PubChem CID | 69089144 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [2-(5-nitrooxypentylcarbamoyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)NCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O6/c1-11(17)22-13-8-4-3-7-12(13)14(18)15-9-5-2-6-10-21-16(19)20/h3-4,7-8H,2,5-6,9-10H2,1H3,(H,15,18) |
| InChIKey | ZWEFKRWLPNHLKD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|