C13H14ClNO4 — CID 142770173
[2-[(4-chloro-4-oxobutyl)carbamoyl]phenyl] acetate (PubChem CID 142770173) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is [2-[(4-chloro-4-oxobutyl)carbamoyl]phenyl] acetate.
| Compound Name | [2-[(4-chloro-4-oxobutyl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 142770173 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | [2-[(4-chloro-4-oxobutyl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)NCCCC(=O)Cl |
| InChI | InChI=1S/C13H14ClNO4/c1-9(16)19-11-6-3-2-5-10(11)13(18)15-8-4-7-12(14)17/h2-3,5-6H,4,7-8H2,1H3,(H,15,18) |
| InChIKey | YUERFQLNMVVBKA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|