C19H23NO4S2 — CID 58492945
2-[[5-(6-methylnaphthalen-2-yl)-4-oxohexyl]disulfanyl]ethyl nitrate (PubChem CID 58492945) has the molecular formula C19H23NO4S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[[5-(6-methylnaphthalen-2-yl)-4-oxohexyl]disulfanyl]ethyl nitrate.
| Compound Name | 2-[[5-(6-methylnaphthalen-2-yl)-4-oxohexyl]disulfanyl]ethyl nitrate |
|---|---|
| PubChem CID | 58492945 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[[5-(6-methylnaphthalen-2-yl)-4-oxohexyl]disulfanyl]ethyl nitrate |
| SMILES | Cc1ccc2cc(C(C)C(=O)CCCSSCCO[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C19H23NO4S2/c1-14-5-6-18-13-16(7-8-17(18)12-14)15(2)19(21)4-3-10-25-26-11-9-24-20(22)23/h5-8,12-13,15H,3-4,9-11H2,1-2H3 |
| InChIKey | QKMQWVAIDDEYKU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|